C21H33FN4 — CID 158550881
2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 158550881) has the molecular formula C21H33FN4 and a molecular weight of 360.52 g/mol. Its IUPAC name is 2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 158550881 |
| Molecular Formula | C21H33FN4 |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 2-butyl-7-[5-[(3S)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCc1nc(N)c2c(n1)C(CCCCCN1CC[C@H](F)C1)=C(C)C2 |
| InChI | InChI=1S/C21H33FN4/c1-3-4-9-19-24-20-17(15(2)13-18(20)21(23)25-19)8-6-5-7-11-26-12-10-16(22)14-26/h16H,3-14H2,1-2H3,(H2,23,24,25)/t16-/m0/s1 |
| InChIKey | HPRVXMQHTJDTKQ-INIZCTEOSA-N |
| XLogP | 4.34 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|