C33H55BrN4O2 — CID 172596345
(5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-methyl-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;molecular hydrogen (PubChem CID 172596345) has the molecular formula C33H55BrN4O2 and a molecular weight of 619.73 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-methyl-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;molecular hydrogen.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-methyl-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;molecular hydrogen |
|---|---|
| PubChem CID | 172596345 |
| Molecular Formula | C33H55BrN4O2 |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-8-methyl-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;molecular hydrogen |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=C(C)c2nc(OCC(C)(CCCC)CCCCCC)nc(N3CCCOCC3)c2\1.[H][H] |
| InChI | InChI=1S/C33H53BrN4O2.H2/c1-8-12-14-15-18-33(7,17-13-9-2)23-40-32-36-29-25(6)28(34)30(35-24(5)10-3)26(11-4)27(29)31(37-32)38-19-16-21-39-22-20-38;/h11,24H,8-10,12-23H2,1-7H3;1H/b26-11-,35-30-; |
| InChIKey | CPJSRROECONMJG-CKWWWYKYSA-N |
| XLogP | 9.28 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|