C27H40BrN3O — CID 172596643
6-bromo-3-[(2S)-2-butyl-2-methyloctoxy]-7-ethyl-1,8-dimethylpyrrolo[3,4-f]quinazoline (PubChem CID 172596643) has the molecular formula C27H40BrN3O and a molecular weight of 502.54 g/mol. Its IUPAC name is 6-bromo-3-[(2S)-2-butyl-2-methyloctoxy]-7-ethyl-1,8-dimethylpyrrolo[3,4-f]quinazoline.
| Compound Name | 6-bromo-3-[(2S)-2-butyl-2-methyloctoxy]-7-ethyl-1,8-dimethylpyrrolo[3,4-f]quinazoline |
|---|---|
| PubChem CID | 172596643 |
| Molecular Formula | C27H40BrN3O |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 6-bromo-3-[(2S)-2-butyl-2-methyloctoxy]-7-ethyl-1,8-dimethylpyrrolo[3,4-f]quinazoline |
| SMILES | CCCCCC[C@](C)(CCCC)COc1nc(C)c2c(cc(Br)c3c(CC)n(C)cc32)n1 |
| InChI | InChI=1S/C27H40BrN3O/c1-7-10-12-13-15-27(5,14-11-8-2)18-32-26-29-19(4)24-20-17-31(6)23(9-3)25(20)21(28)16-22(24)30-26/h16-17H,7-15,18H2,1-6H3/t27-/m0/s1 |
| InChIKey | JOJUSFMBNWJIFA-MHZLTWQESA-N |
| XLogP | 8.30 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|