C36H56BrN7O2 — CID 172596459
(Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide (PubChem CID 172596459) has the molecular formula C36H56BrN7O2 and a molecular weight of 698.80 g/mol. Its IUPAC name is (Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | (Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 172596459 |
| Molecular Formula | C36H56BrN7O2 |
| Molecular Weight | 698.80 g/mol |
| Exact Mass | 697.37 |
| IUPAC Name | (Z)-2-amino-3-[1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCC)nc(N3CCCN=C(/C=C(\N)C(=O)N(C)C)C3)c2\1 |
| InChI | InChI=1S/C36H56BrN7O2/c1-9-13-15-18-36(6,17-14-10-2)24-46-35-41-30-22-28(37)32(40-25(5)11-3)27(12-4)31(30)33(42-35)44-20-16-19-39-26(23-44)21-29(38)34(45)43(7)8/h12,21-22,25H,9-11,13-20,23-24,38H2,1-8H3/b27-12-,29-21-,40-32- |
| InChIKey | HJSQEVKSLUQUPY-LFQWHSCGSA-N |
| XLogP | 7.61 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.80 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|