C18H28N4 — CID 172597494
3,11-dimethyl-6-pentyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene;ethane (PubChem CID 172597494) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 3,11-dimethyl-6-pentyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene;ethane.
| Compound Name | 3,11-dimethyl-6-pentyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene;ethane |
|---|---|
| PubChem CID | 172597494 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 3,11-dimethyl-6-pentyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene;ethane |
| SMILES | CC.CCCCCN1CCc2nc(C)cc3nc(C)nc1c23 |
| InChI | InChI=1S/C16H22N4.C2H6/c1-4-5-6-8-20-9-7-13-15-14(10-11(2)17-13)18-12(3)19-16(15)20;1-2/h10H,4-9H2,1-3H3;1-2H3 |
| InChIKey | ODPPUOLCVZYRSO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|