C15H19NO — CID 172601239
N-[4-(3-methylbut-1-ynyl)phenyl]cyclopropanecarboxamide;molecular hydrogen (PubChem CID 172601239) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[4-(3-methylbut-1-ynyl)phenyl]cyclopropanecarboxamide;molecular hydrogen.
| Compound Name | N-[4-(3-methylbut-1-ynyl)phenyl]cyclopropanecarboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 172601239 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-[4-(3-methylbut-1-ynyl)phenyl]cyclopropanecarboxamide;molecular hydrogen |
| SMILES | CC(C)C#Cc1ccc(NC(=O)C2CC2)cc1.[H][H] |
| InChI | InChI=1S/C15H17NO.H2/c1-11(2)3-4-12-5-9-14(10-6-12)16-15(17)13-7-8-13;/h5-6,9-11,13H,7-8H2,1-2H3,(H,16,17);1H |
| InChIKey | AXUPGAHPWPZFPC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|