C24H30FN7O2 — CID 172601505
tert-butyl 4-[6-[[amino-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)methylidene]amino]-3-pyridinyl]-1,4-diazepane-1-carboxylate (PubChem CID 172601505) has the molecular formula C24H30FN7O2 and a molecular weight of 467.55 g/mol. Its IUPAC name is tert-butyl 4-[6-[[amino-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)methylidene]amino]-3-pyridinyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[[amino-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)methylidene]amino]-3-pyridinyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 172601505 |
| Molecular Formula | C24H30FN7O2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | tert-butyl 4-[6-[[amino-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)methylidene]amino]-3-pyridinyl]-1,4-diazepane-1-carboxylate |
| SMILES | Cc1cn2cc(/C(N)=N/c3ccc(N4CCCN(C(=O)OC(C)(C)C)CC4)cn3)cc(F)c2n1 |
| InChI | InChI=1S/C24H30FN7O2/c1-16-14-32-15-17(12-19(25)22(32)28-16)21(26)29-20-7-6-18(13-27-20)30-8-5-9-31(11-10-30)23(33)34-24(2,3)4/h6-7,12-15H,5,8-11H2,1-4H3,(H2,26,27,29) |
| InChIKey | NFLONNNBYBVUEA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|