C25H35N7O2 — CID 172601521
tert-butyl 4-[6-(aminomethylideneamino)-3-pyridinyl]piperazine-1-carboxylate;2,6,8-trimethylimidazo[1,2-a]pyridine (PubChem CID 172601521) has the molecular formula C25H35N7O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is tert-butyl 4-[6-(aminomethylideneamino)-3-pyridinyl]piperazine-1-carboxylate;2,6,8-trimethylimidazo[1,2-a]pyridine.
| Compound Name | tert-butyl 4-[6-(aminomethylideneamino)-3-pyridinyl]piperazine-1-carboxylate;2,6,8-trimethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 172601521 |
| Molecular Formula | C25H35N7O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | tert-butyl 4-[6-(aminomethylideneamino)-3-pyridinyl]piperazine-1-carboxylate;2,6,8-trimethylimidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(/N=C/N)nc2)CC1.Cc1cc(C)c2nc(C)cn2c1 |
| InChI | InChI=1S/C15H23N5O2.C10H12N2/c1-15(2,3)22-14(21)20-8-6-19(7-9-20)12-4-5-13(17-10-12)18-11-16;1-7-4-8(2)10-11-9(3)6-12(10)5-7/h4-5,10-11H,6-9H2,1-3H3,(H2,16,17,18);4-6H,1-3H3 |
| InChIKey | GQATXOVKAVHNHH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|