C14H21BrN6O2 — CID 122502392
tert-butyl 4-[4-(aminomethylideneamino)-5-bromopyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 122502392) has the molecular formula C14H21BrN6O2 and a molecular weight of 385.27 g/mol. Its IUPAC name is tert-butyl 4-[4-(aminomethylideneamino)-5-bromopyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(aminomethylideneamino)-5-bromopyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122502392 |
| Molecular Formula | C14H21BrN6O2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | tert-butyl 4-[4-(aminomethylideneamino)-5-bromopyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(Br)c(/N=C/N)n2)CC1 |
| InChI | InChI=1S/C14H21BrN6O2/c1-14(2,3)23-13(22)21-6-4-20(5-7-21)12-17-8-10(15)11(19-12)18-9-16/h8-9H,4-7H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | POSIFEFEHBLCIN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|