C11H12F3N — CID 172602253
N-methyl-3-[1-(trifluoromethyl)cyclopropyl]aniline (PubChem CID 172602253) has the molecular formula C11H12F3N and a molecular weight of 215.22 g/mol. Its IUPAC name is N-methyl-3-[1-(trifluoromethyl)cyclopropyl]aniline.
| Compound Name | N-methyl-3-[1-(trifluoromethyl)cyclopropyl]aniline |
|---|---|
| PubChem CID | 172602253 |
| Molecular Formula | C11H12F3N |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | N-methyl-3-[1-(trifluoromethyl)cyclopropyl]aniline |
| SMILES | CNc1cccc(C2(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C11H12F3N/c1-15-9-4-2-3-8(7-9)10(5-6-10)11(12,13)14/h2-4,7,15H,5-6H2,1H3 |
| InChIKey | AEDSFOQBAAJKJR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |