C17H35N3O3 — CID 172602407
2,2,4-trimethyl-N-[2-methyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]oxybutan-2-yl]pentanamide (PubChem CID 172602407) has the molecular formula C17H35N3O3 and a molecular weight of 329.49 g/mol. Its IUPAC name is 2,2,4-trimethyl-N-[2-methyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]oxybutan-2-yl]pentanamide.
| Compound Name | 2,2,4-trimethyl-N-[2-methyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]oxybutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 172602407 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 2,2,4-trimethyl-N-[2-methyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]oxybutan-2-yl]pentanamide |
| SMILES | CNC(=O)CN(C)OCCC(C)(C)NC(=O)C(C)(C)CC(C)C |
| InChI | InChI=1S/C17H35N3O3/c1-13(2)11-16(3,4)15(22)19-17(5,6)9-10-23-20(8)12-14(21)18-7/h13H,9-12H2,1-8H3,(H,18,21)(H,19,22) |
| InChIKey | LLPUKGXPZMNYBR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|