C17H35NO4 — CID 172605822
2-[2-[2-(2-amino-2-methylpropoxy)propan-2-yl]-4-methoxy-2,4-dimethylpentoxy]acetaldehyde (PubChem CID 172605822) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-[2-[2-(2-amino-2-methylpropoxy)propan-2-yl]-4-methoxy-2,4-dimethylpentoxy]acetaldehyde.
| Compound Name | 2-[2-[2-(2-amino-2-methylpropoxy)propan-2-yl]-4-methoxy-2,4-dimethylpentoxy]acetaldehyde |
|---|---|
| PubChem CID | 172605822 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 2-[2-[2-(2-amino-2-methylpropoxy)propan-2-yl]-4-methoxy-2,4-dimethylpentoxy]acetaldehyde |
| SMILES | COC(C)(C)CC(C)(COCC=O)C(C)(C)OCC(C)(C)N |
| InChI | InChI=1S/C17H35NO4/c1-14(2,18)12-22-16(5,6)17(7,13-21-10-9-19)11-15(3,4)20-8/h9H,10-13,18H2,1-8H3 |
| InChIKey | LEPIOBJJZCHDKY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|