3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid

C6H8FN3O2 — CID 172605828

IUPAC3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid
SMILESCc1nc(C(F)CC(=O)O)n[nH]1
InChIInChI=1S/C6H8FN3O2/c1-3-8-6(10-9-3)4(7)2-5(11)12/h4H,2H2,1H3,(H,11,12)(H,8,9,10)
InChIKeyQNRMIFJBVVTSSD-UHFFFAOYSA-N
MW173.15 g/mol
LogP0.60
Rot. Bonds3

About 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid

3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid (PubChem CID 172605828) has the molecular formula C6H8FN3O2 and a molecular weight of 173.15 g/mol. Its IUPAC name is 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid.

Molecular Properties

Compound Name3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid
PubChem CID172605828
Molecular FormulaC6H8FN3O2
Molecular Weight173.15 g/mol
Exact Mass173.06
IUPAC Name3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid
SMILESCc1nc(C(F)CC(=O)O)n[nH]1
InChIInChI=1S/C6H8FN3O2/c1-3-8-6(10-9-3)4(7)2-5(11)12/h4H,2H2,1H3,(H,11,12)(H,8,9,10)
InChIKeyQNRMIFJBVVTSSD-UHFFFAOYSA-N
XLogP0.60
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.15
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
The IUPAC name of 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid (CID 172605828) is 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid.
What is the SMILES notation for 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
The canonical SMILES for 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid is Cc1nc(C(F)CC(=O)O)n[nH]1.
What is the InChIKey of 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
The InChIKey is QNRMIFJBVVTSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FN3O2/c1-3-8-6(10-9-3)4(7)2-5(11)12/h4H,2H2,1H3,(H,11,12)(H,8,9,10).
What are the key properties of 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid has a molecular weight of 173.15 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid is sourced from PubChem (CID 172605828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).