C22H22Cl2N6O3 — CID 172606396
(E)-2-(2-chloro-4,5-dimethoxyphenyl)-2-[1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3-methylpyrazol-4-yl]-N-methoxyethenamine (PubChem CID 172606396) has the molecular formula C22H22Cl2N6O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is (E)-2-(2-chloro-4,5-dimethoxyphenyl)-2-[1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3-methylpyrazol-4-yl]-N-methoxyethenamine.
| Compound Name | (E)-2-(2-chloro-4,5-dimethoxyphenyl)-2-[1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3-methylpyrazol-4-yl]-N-methoxyethenamine |
|---|---|
| PubChem CID | 172606396 |
| Molecular Formula | C22H22Cl2N6O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | (E)-2-(2-chloro-4,5-dimethoxyphenyl)-2-[1-[(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)methyl]-3-methylpyrazol-4-yl]-N-methoxyethenamine |
| SMILES | CON/C=C(/c1cc(OC)c(OC)cc1Cl)c1cn(Cc2nc3nc(Cl)ccc3[nH]2)nc1C |
| InChI | InChI=1S/C22H22Cl2N6O3/c1-12-15(10-30(29-12)11-21-26-17-5-6-20(24)27-22(17)28-21)14(9-25-33-4)13-7-18(31-2)19(32-3)8-16(13)23/h5-10,25H,11H2,1-4H3,(H,26,27,28)/b14-9- |
| InChIKey | CVNBHQVLUNXTNM-ZROIWOOFSA-N |
| XLogP | 4.38 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|