C26H17FN4O2 — CID 172607296
4-(5-anilino-2-methoxypyrido[4,3-d]pyrimidin-7-yl)-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 172607296) has the molecular formula C26H17FN4O2 and a molecular weight of 436.45 g/mol. Its IUPAC name is 4-(5-anilino-2-methoxypyrido[4,3-d]pyrimidin-7-yl)-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-(5-anilino-2-methoxypyrido[4,3-d]pyrimidin-7-yl)-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 172607296 |
| Molecular Formula | C26H17FN4O2 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-(5-anilino-2-methoxypyrido[4,3-d]pyrimidin-7-yl)-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3cc4nc(OC)ncc4c(Nc4ccccc4)n3)c12 |
| InChI | InChI=1S/C26H17FN4O2/c1-3-18-21(27)10-9-15-11-17(32)12-19(24(15)18)22-13-23-20(14-28-26(31-23)33-2)25(30-22)29-16-7-5-4-6-8-16/h1,4-14,32H,2H3,(H,29,30) |
| InChIKey | MLBMFQSWRQGYBM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|