C23H17FN4O2 — CID 172607329
4-[5-(azetidin-1-yl)-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 172607329) has the molecular formula C23H17FN4O2 and a molecular weight of 400.41 g/mol. Its IUPAC name is 4-[5-(azetidin-1-yl)-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[5-(azetidin-1-yl)-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 172607329 |
| Molecular Formula | C23H17FN4O2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-[5-(azetidin-1-yl)-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3cc4nc(OC)ncc4c(N4CCC4)n3)c12 |
| InChI | InChI=1S/C23H17FN4O2/c1-3-15-18(24)6-5-13-9-14(29)10-16(21(13)15)19-11-20-17(12-25-23(27-20)30-2)22(26-19)28-7-4-8-28/h1,5-6,9-12,29H,4,7-8H2,2H3 |
| InChIKey | NADGYMDXTPPOAG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|