C26H21FN4O3 — CID 172607476
5-ethynyl-6-fluoro-4-[2-methoxy-5-(2-oxa-5-azaspiro[3.4]octan-5-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 172607476) has the molecular formula C26H21FN4O3 and a molecular weight of 456.48 g/mol. Its IUPAC name is 5-ethynyl-6-fluoro-4-[2-methoxy-5-(2-oxa-5-azaspiro[3.4]octan-5-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 5-ethynyl-6-fluoro-4-[2-methoxy-5-(2-oxa-5-azaspiro[3.4]octan-5-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 172607476 |
| Molecular Formula | C26H21FN4O3 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 5-ethynyl-6-fluoro-4-[2-methoxy-5-(2-oxa-5-azaspiro[3.4]octan-5-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3cc4nc(OC)ncc4c(N4CCCC45COC5)n3)c12 |
| InChI | InChI=1S/C26H21FN4O3/c1-3-17-20(27)6-5-15-9-16(32)10-18(23(15)17)21-11-22-19(12-28-25(30-22)33-2)24(29-21)31-8-4-7-26(31)13-34-14-26/h1,5-6,9-12,32H,4,7-8,13-14H2,2H3 |
| InChIKey | IGVYHYXTZHFRAN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|