C33H34ClN9O5S — CID 172610839
4-[[[4-[5-chloro-2-[[1-[[2-(2,4-dioxo-1,3-diazinan-1-yl)-1,3-dioxoisoindol-5-yl]methyl]piperidin-4-yl]amino]-4-pyridinyl]-1,3-thiazol-2-yl]amino]methyl]oxane-4-carbonitrile (PubChem CID 172610839) has the molecular formula C33H34ClN9O5S and a molecular weight of 704.21 g/mol. Its IUPAC name is 4-[[[4-[5-chloro-2-[[1-[[2-(2,4-dioxo-1,3-diazinan-1-yl)-1,3-dioxoisoindol-5-yl]methyl]piperidin-4-yl]amino]-4-pyridinyl]-1,3-thiazol-2-yl]amino]methyl]oxane-4-carbonitrile.
| Compound Name | 4-[[[4-[5-chloro-2-[[1-[[2-(2,4-dioxo-1,3-diazinan-1-yl)-1,3-dioxoisoindol-5-yl]methyl]piperidin-4-yl]amino]-4-pyridinyl]-1,3-thiazol-2-yl]amino]methyl]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 172610839 |
| Molecular Formula | C33H34ClN9O5S |
| Molecular Weight | 704.21 g/mol |
| Exact Mass | 703.21 |
| IUPAC Name | 4-[[[4-[5-chloro-2-[[1-[[2-(2,4-dioxo-1,3-diazinan-1-yl)-1,3-dioxoisoindol-5-yl]methyl]piperidin-4-yl]amino]-4-pyridinyl]-1,3-thiazol-2-yl]amino]methyl]oxane-4-carbonitrile |
| SMILES | N#CC1(CNc2nc(-c3cc(NC4CCN(Cc5ccc6c(c5)C(=O)N(N5CCC(=O)NC5=O)C6=O)CC4)ncc3Cl)cs2)CCOCC1 |
| InChI | InChI=1S/C33H34ClN9O5S/c34-25-15-36-27(14-24(25)26-17-49-31(39-26)37-19-33(18-35)6-11-48-12-7-33)38-21-3-8-41(9-4-21)16-20-1-2-22-23(13-20)30(46)43(29(22)45)42-10-5-28(44)40-32(42)47/h1-2,13-15,17,21H,3-12,16,19H2,(H,36,38)(H,37,39)(H,40,44,47) |
| InChIKey | PMXCCFTXQVPUBS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 172.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|