C28H52N4O12 — CID 172611592
1-[2-[10-methyl-3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one;2-methylpropane (PubChem CID 172611592) has the molecular formula C28H52N4O12 and a molecular weight of 636.74 g/mol. Its IUPAC name is 1-[2-[10-methyl-3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one;2-methylpropane.
| Compound Name | 1-[2-[10-methyl-3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one;2-methylpropane |
|---|---|
| PubChem CID | 172611592 |
| Molecular Formula | C28H52N4O12 |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | 1-[2-[10-methyl-3-[(2,2,3,3,4,4,5,5-octahydroxypyrrolidin-1-yl)methyl]-1,5-dioxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one;2-methylpropane |
| SMILES | CC(C)C.CC(C)CC1NCCN(CC(=O)N2CCC3(CC2C)OCC(CN2C(O)(O)C(O)(O)C(O)(O)C2(O)O)CO3)C1=O |
| InChI | InChI=1S/C24H42N4O12.C4H10/c1-14(2)8-17-19(30)26(7-5-25-17)11-18(29)27-6-4-20(9-15(27)3)39-12-16(13-40-20)10-28-23(35,36)21(31,32)22(33,34)24(28,37)38;1-4(2)3/h14-17,25,31-38H,4-13H2,1-3H3;4H,1-3H3 |
| InChIKey | RFDOCKPDDWPFRO-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 236.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|