C27H28F3N3O3S — CID 172613291
cis-(1R,3S)-1-[[2,4-difluoro-5-(3-fluoro-2-phenylmethoxyphenyl)phenyl]methyl]-3-(methanesulfonamido)cyclopentane-1-carboximidamide (PubChem CID 172613291) has the molecular formula C27H28F3N3O3S and a molecular weight of 531.60 g/mol. Its IUPAC name is cis-(1R,3S)-1-[[2,4-difluoro-5-(3-fluoro-2-phenylmethoxyphenyl)phenyl]methyl]-3-(methanesulfonamido)cyclopentane-1-carboximidamide.
| Compound Name | cis-(1R,3S)-1-[[2,4-difluoro-5-(3-fluoro-2-phenylmethoxyphenyl)phenyl]methyl]-3-(methanesulfonamido)cyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 172613291 |
| Molecular Formula | C27H28F3N3O3S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | cis-(1R,3S)-1-[[2,4-difluoro-5-(3-fluoro-2-phenylmethoxyphenyl)phenyl]methyl]-3-(methanesulfonamido)cyclopentane-1-carboximidamide |
| SMILES | [H]/N=C(\N)[C@@]1(Cc2cc(-c3cccc(F)c3OCc3ccccc3)c(F)cc2F)CC[C@H](NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C27H28F3N3O3S/c1-37(34,35)33-19-10-11-27(15-19,26(31)32)14-18-12-21(24(30)13-23(18)29)20-8-5-9-22(28)25(20)36-16-17-6-3-2-4-7-17/h2-9,12-13,19,33H,10-11,14-16H2,1H3,(H3,31,32)/t19-,27+/m0/s1 |
| InChIKey | FOUGQAGHAFBYGH-UZTOHYMASA-N |
| XLogP | 4.92 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|