About 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane
1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane (PubChem CID 172614909) has the molecular formula C16H26ClF3N2O
and a molecular weight of 354.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane |
| PubChem CID | 172614909 |
| Molecular Formula | C16H26ClF3N2O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane |
| SMILES | C1COCCN1.CCC.CNC(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N.C4H9NO.C3H8/c1-14-8(9(11,12)13)6-2-4-7(10)5-3-6;1-3-6-4-2-5-1;1-3-2/h2-5,8,14H,1H3;5H,1-4H2;3H2,1-2H3 |
| InChIKey | FUQPWDAJRSEUMX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane?
The IUPAC name of 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane (CID 172614909) is 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane.
What is the SMILES notation for 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane?
The canonical SMILES for 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane is C1COCCN1.CCC.CNC(c1ccc(Cl)cc1)C(F)(F)F.
What is the InChIKey of 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane?
The InChIKey is FUQPWDAJRSEUMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF3N.C4H9NO.C3H8/c1-14-8(9(11,12)13)6-2-4-7(10)5-3-6;1-3-6-4-2-5-1;1-3-2/h2-5,8,14H,1H3;5H,1-4H2;3H2,1-2H3.
What are the key properties of 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane?
1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane has a molecular weight of 354.84 g/mol, XLogP of 4.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;morpholine;propane is sourced from PubChem (CID 172614909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).