C33H25FN4O3S — CID 172616326
3-[2-(4-fluorophenyl)ethynyl]-N-(imidazo[1,2-a]pyridin-7-ylmethyl)-4-[(1-methylindol-6-yl)methylsulfonyl]benzamide (PubChem CID 172616326) has the molecular formula C33H25FN4O3S and a molecular weight of 576.65 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethynyl]-N-(imidazo[1,2-a]pyridin-7-ylmethyl)-4-[(1-methylindol-6-yl)methylsulfonyl]benzamide.
| Compound Name | 3-[2-(4-fluorophenyl)ethynyl]-N-(imidazo[1,2-a]pyridin-7-ylmethyl)-4-[(1-methylindol-6-yl)methylsulfonyl]benzamide |
|---|---|
| PubChem CID | 172616326 |
| Molecular Formula | C33H25FN4O3S |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethynyl]-N-(imidazo[1,2-a]pyridin-7-ylmethyl)-4-[(1-methylindol-6-yl)methylsulfonyl]benzamide |
| SMILES | Cn1ccc2ccc(CS(=O)(=O)c3ccc(C(=O)NCc4ccn5ccnc5c4)cc3C#Cc3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C33H25FN4O3S/c1-37-15-13-26-6-3-25(18-30(26)37)22-42(40,41)31-11-8-28(20-27(31)7-2-23-4-9-29(34)10-5-23)33(39)36-21-24-12-16-38-17-14-35-32(38)19-24/h3-6,8-20H,21-22H2,1H3,(H,36,39) |
| InChIKey | JCVCAIRFXPIKEZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|