C23H14F4O4S — CID 172616446
3-[2-(4-fluorophenyl)ethynyl]-4-[[4-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 172616446) has the molecular formula C23H14F4O4S and a molecular weight of 462.42 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethynyl]-4-[[4-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 3-[2-(4-fluorophenyl)ethynyl]-4-[[4-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 172616446 |
| Molecular Formula | C23H14F4O4S |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethynyl]-4-[[4-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Cc2ccc(C(F)(F)F)cc2)c(C#Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H14F4O4S/c24-20-10-4-15(5-11-20)1-6-17-13-18(22(28)29)7-12-21(17)32(30,31)14-16-2-8-19(9-3-16)23(25,26)27/h2-5,7-13H,14H2,(H,28,29) |
| InChIKey | XBMFLZGUICUBCJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|