C28H32N5O2+ — CID 172617383
4,18,28-trimethyl-8-oxa-15,22,24,29-tetraza-4-azoniahexacyclo[24.3.1.110,13.02,7.015,23.016,21]hentriaconta-1(29),2(7),3,16(21),17,19,22,26(30),27-nonaen-25-one (PubChem CID 172617383) has the molecular formula C28H32N5O2+ and a molecular weight of 470.60 g/mol. Its IUPAC name is 4,18,28-trimethyl-8-oxa-15,22,24,29-tetraza-4-azoniahexacyclo[24.3.1.110,13.02,7.015,23.016,21]hentriaconta-1(29),2(7),3,16(21),17,19,22,26(30),27-nonaen-25-one.
| Compound Name | 4,18,28-trimethyl-8-oxa-15,22,24,29-tetraza-4-azoniahexacyclo[24.3.1.110,13.02,7.015,23.016,21]hentriaconta-1(29),2(7),3,16(21),17,19,22,26(30),27-nonaen-25-one |
|---|---|
| PubChem CID | 172617383 |
| Molecular Formula | C28H32N5O2+ |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 4,18,28-trimethyl-8-oxa-15,22,24,29-tetraza-4-azoniahexacyclo[24.3.1.110,13.02,7.015,23.016,21]hentriaconta-1(29),2(7),3,16(21),17,19,22,26(30),27-nonaen-25-one |
| SMILES | Cc1ccc2nc3n(c2c1)CC1CCC(COC2=C(C=[N+](C)CC2)c2cc(cc(C)n2)C(=O)N3)C1 |
| InChI | InChI=1S/C28H31N5O2/c1-17-4-7-23-25(10-17)33-14-19-5-6-20(12-19)16-35-26-8-9-32(3)15-22(26)24-13-21(11-18(2)29-24)27(34)31-28(33)30-23/h4,7,10-11,13,15,19-20H,5-6,8-9,12,14,16H2,1-3H3/p+1 |
| InChIKey | PTRCXABBPHWNHX-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|