C29H33ClN8O2 — CID 176725275
(9S,12R)-27-chloro-3,5-dimethyl-17-piperazin-1-yl-7-oxa-4,5,14,21,23,28-hexazahexacyclo[23.3.1.19,12.02,6.014,22.015,20]triaconta-1(28),2(6),3,15(20),16,18,21,25(29),26-nonaen-24-one (PubChem CID 176725275) has the molecular formula C29H33ClN8O2 and a molecular weight of 561.09 g/mol. Its IUPAC name is (9S,12R)-27-chloro-3,5-dimethyl-17-piperazin-1-yl-7-oxa-4,5,14,21,23,28-hexazahexacyclo[23.3.1.19,12.02,6.014,22.015,20]triaconta-1(28),2(6),3,15(20),16,18,21,25(29),26-nonaen-24-one.
| Compound Name | (9S,12R)-27-chloro-3,5-dimethyl-17-piperazin-1-yl-7-oxa-4,5,14,21,23,28-hexazahexacyclo[23.3.1.19,12.02,6.014,22.015,20]triaconta-1(28),2(6),3,15(20),16,18,21,25(29),26-nonaen-24-one |
|---|---|
| PubChem CID | 176725275 |
| Molecular Formula | C29H33ClN8O2 |
| Molecular Weight | 561.09 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (9S,12R)-27-chloro-3,5-dimethyl-17-piperazin-1-yl-7-oxa-4,5,14,21,23,28-hexazahexacyclo[23.3.1.19,12.02,6.014,22.015,20]triaconta-1(28),2(6),3,15(20),16,18,21,25(29),26-nonaen-24-one |
| SMILES | Cc1nn(C)c2c1-c1cc(cc(Cl)n1)C(=O)Nc1nc3ccc(N4CCNCC4)cc3n1C[C@@H]1CC[C@H](CO2)C1 |
| InChI | InChI=1S/C29H33ClN8O2/c1-17-26-23-12-20(13-25(30)32-23)27(39)34-29-33-22-6-5-21(37-9-7-31-8-10-37)14-24(22)38(29)15-18-3-4-19(11-18)16-40-28(26)36(2)35-17/h5-6,12-14,18-19,31H,3-4,7-11,15-16H2,1-2H3,(H,33,34,39)/t18-,19+/m1/s1 |
| InChIKey | GVQCKVDWXWWSHW-MOPGFXCFSA-N |
| XLogP | 4.26 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|