C17H21ClN4O2 — CID 172619042
4-pentyl-N'-(pyridine-4-carbonyl)pyridine-2-carbohydrazide;hydrochloride (PubChem CID 172619042) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 4-pentyl-N'-(pyridine-4-carbonyl)pyridine-2-carbohydrazide;hydrochloride.
| Compound Name | 4-pentyl-N'-(pyridine-4-carbonyl)pyridine-2-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 172619042 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-pentyl-N'-(pyridine-4-carbonyl)pyridine-2-carbohydrazide;hydrochloride |
| SMILES | CCCCCc1ccnc(C(=O)NNC(=O)c2ccncc2)c1.Cl |
| InChI | InChI=1S/C17H20N4O2.ClH/c1-2-3-4-5-13-6-11-19-15(12-13)17(23)21-20-16(22)14-7-9-18-10-8-14;/h6-12H,2-5H2,1H3,(H,20,22)(H,21,23);1H |
| InChIKey | YHDVHCYUNLPBNX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|