C17H21N5O2 — CID 172619090
N'-(2-aminopyridine-4-carbonyl)-5-pentylpyridine-2-carbohydrazide (PubChem CID 172619090) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N'-(2-aminopyridine-4-carbonyl)-5-pentylpyridine-2-carbohydrazide.
| Compound Name | N'-(2-aminopyridine-4-carbonyl)-5-pentylpyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 172619090 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N'-(2-aminopyridine-4-carbonyl)-5-pentylpyridine-2-carbohydrazide |
| SMILES | CCCCCc1ccc(C(=O)NNC(=O)c2ccnc(N)c2)nc1 |
| InChI | InChI=1S/C17H21N5O2/c1-2-3-4-5-12-6-7-14(20-11-12)17(24)22-21-16(23)13-8-9-19-15(18)10-13/h6-11H,2-5H2,1H3,(H2,18,19)(H,21,23)(H,22,24) |
| InChIKey | TZSGIEHYBWJCBF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|