C21H35NO4S — CID 172620544
ethane;3-methyl-4-[[4-(3-methylsulfonyloxetan-3-yl)phenoxy]methyl]-1-propylpyrrolidine (PubChem CID 172620544) has the molecular formula C21H35NO4S and a molecular weight of 397.58 g/mol. Its IUPAC name is ethane;3-methyl-4-[[4-(3-methylsulfonyloxetan-3-yl)phenoxy]methyl]-1-propylpyrrolidine.
| Compound Name | ethane;3-methyl-4-[[4-(3-methylsulfonyloxetan-3-yl)phenoxy]methyl]-1-propylpyrrolidine |
|---|---|
| PubChem CID | 172620544 |
| Molecular Formula | C21H35NO4S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | ethane;3-methyl-4-[[4-(3-methylsulfonyloxetan-3-yl)phenoxy]methyl]-1-propylpyrrolidine |
| SMILES | CC.CCCN1CC(C)C(COc2ccc(C3(S(C)(=O)=O)COC3)cc2)C1 |
| InChI | InChI=1S/C19H29NO4S.C2H6/c1-4-9-20-10-15(2)16(11-20)12-24-18-7-5-17(6-8-18)19(13-23-14-19)25(3,21)22;1-2/h5-8,15-16H,4,9-14H2,1-3H3;1-2H3 |
| InChIKey | NQQAGWWCSQGYET-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |