C22H40O5 — CID 172621222
[5-(hexoxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl oct-7-enoate (PubChem CID 172621222) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is [5-(hexoxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl oct-7-enoate.
| Compound Name | [5-(hexoxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl oct-7-enoate |
|---|---|
| PubChem CID | 172621222 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | [5-(hexoxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methyl oct-7-enoate |
| SMILES | C=CCCCCCC(=O)OCC1(COCCCCCC)COC(C)(C)OC1 |
| InChI | InChI=1S/C22H40O5/c1-5-7-9-11-12-14-20(23)25-17-22(16-24-15-13-10-8-6-2)18-26-21(3,4)27-19-22/h5H,1,6-19H2,2-4H3 |
| InChIKey | WZQDUJKJCNRSFE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|