C29H33N3O3S — CID 172622793
[(1R)-1-phenylethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate (PubChem CID 172622793) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate.
| Compound Name | [(1R)-1-phenylethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 172622793 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | [(1R)-1-phenylethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate |
| SMILES | C=C(O)C1(c2ccc(N3CCC(c4snc(C)c4NC(=O)O[C@H](C)c4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C29H33N3O3S/c1-19-26(30-28(34)35-20(2)22-7-5-4-6-8-22)27(36-31-19)23-13-17-32(18-14-23)25-11-9-24(10-12-25)29(15-16-29)21(3)33/h4-12,20,23,33H,3,13-18H2,1-2H3,(H,30,34)/t20-/m1/s1 |
| InChIKey | XFWNIPBHRKZTFD-HXUWFJFHSA-N |
| XLogP | 7.25 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|