C29H32FN3O3S — CID 172622736
[(1R)-1-(2-fluorophenyl)ethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate (PubChem CID 172622736) has the molecular formula C29H32FN3O3S and a molecular weight of 521.66 g/mol. Its IUPAC name is [(1R)-1-(2-fluorophenyl)ethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2-fluorophenyl)ethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 172622736 |
| Molecular Formula | C29H32FN3O3S |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | [(1R)-1-(2-fluorophenyl)ethyl] N-[5-[1-[4-[1-(1-hydroxyethenyl)cyclopropyl]phenyl]piperidin-4-yl]-3-methyl-1,2-thiazol-4-yl]carbamate |
| SMILES | C=C(O)C1(c2ccc(N3CCC(c4snc(C)c4NC(=O)O[C@H](C)c4ccccc4F)CC3)cc2)CC1 |
| InChI | InChI=1S/C29H32FN3O3S/c1-18-26(31-28(35)36-19(2)24-6-4-5-7-25(24)30)27(37-32-18)21-12-16-33(17-13-21)23-10-8-22(9-11-23)29(14-15-29)20(3)34/h4-11,19,21,34H,3,12-17H2,1-2H3,(H,31,35)/t19-/m1/s1 |
| InChIKey | ZAUCQKQIURQGBE-LJQANCHMSA-N |
| XLogP | 7.39 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|