C27H31N5O2 — CID 172624106
tert-butyl N-[(3R)-1-[6-(benzhydrylideneamino)pyridazin-3-yl]piperidin-3-yl]carbamate (PubChem CID 172624106) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[6-(benzhydrylideneamino)pyridazin-3-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[6-(benzhydrylideneamino)pyridazin-3-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172624106 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | tert-butyl N-[(3R)-1-[6-(benzhydrylideneamino)pyridazin-3-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(c2ccc(N=C(c3ccccc3)c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C27H31N5O2/c1-27(2,3)34-26(33)28-22-15-10-18-32(19-22)24-17-16-23(30-31-24)29-25(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-9,11-14,16-17,22H,10,15,18-19H2,1-3H3,(H,28,33)/t22-/m1/s1 |
| InChIKey | HQNNCCZWSUABMB-JOCHJYFZSA-N |
| XLogP | 5.14 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|