C43H51F2N3S3 — CID 172624849
4-[11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]-2,6-difluorobenzonitrile (PubChem CID 172624849) has the molecular formula C43H51F2N3S3 and a molecular weight of 744.10 g/mol. Its IUPAC name is 4-[11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 172624849 |
| Molecular Formula | C43H51F2N3S3 |
| Molecular Weight | 744.10 g/mol |
| Exact Mass | 743.32 |
| IUPAC Name | 4-[11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]-2,6-difluorobenzonitrile |
| SMILES | CCCCCCN(CCCCCC)c1ccc(-c2cc3c(s2)c2sc4cc(-c5cc(F)c(C#N)c(F)c5)sc4c2n3CC(CC)CCCC)cc1 |
| InChI | InChI=1S/C43H51F2N3S3/c1-5-9-12-14-21-47(22-15-13-10-6-2)32-19-17-30(18-20-32)37-25-36-41(49-37)43-40(48(36)28-29(8-4)16-11-7-3)42-39(51-43)26-38(50-42)31-23-34(44)33(27-46)35(45)24-31/h17-20,23-26,29H,5-16,21-22,28H2,1-4H3 |
| InChIKey | IQWCUZJWSCAAFT-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.10 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|