C20H27ClN4O2 — CID 172626207
1-[1-[2-chloro-5-[1-(oxan-4-yl)pyrazol-4-yl]-4-pyridinyl]piperidin-4-yl]ethanol (PubChem CID 172626207) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 1-[1-[2-chloro-5-[1-(oxan-4-yl)pyrazol-4-yl]-4-pyridinyl]piperidin-4-yl]ethanol.
| Compound Name | 1-[1-[2-chloro-5-[1-(oxan-4-yl)pyrazol-4-yl]-4-pyridinyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 172626207 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[1-[2-chloro-5-[1-(oxan-4-yl)pyrazol-4-yl]-4-pyridinyl]piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(c2cc(Cl)ncc2-c2cnn(C3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C20H27ClN4O2/c1-14(26)15-2-6-24(7-3-15)19-10-20(21)22-12-18(19)16-11-23-25(13-16)17-4-8-27-9-5-17/h10-15,17,26H,2-9H2,1H3 |
| InChIKey | IUAYZVRFXFSXNB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|