About (4-oxobutanoylamino) pyrrolidine-2-carboxylate
(4-oxobutanoylamino) pyrrolidine-2-carboxylate (PubChem CID 172627054) has the molecular formula C9H14N2O4
and a molecular weight of 214.22 g/mol. Its IUPAC name is (4-oxobutanoylamino) pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (4-oxobutanoylamino) pyrrolidine-2-carboxylate |
| PubChem CID | 172627054 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (4-oxobutanoylamino) pyrrolidine-2-carboxylate |
| SMILES | O=CCCC(=O)NOC(=O)C1CCCN1 |
| InChI | InChI=1S/C9H14N2O4/c12-6-2-4-8(13)11-15-9(14)7-3-1-5-10-7/h6-7,10H,1-5H2,(H,11,13) |
| InChIKey | TZTYYMSKFQCQLB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-oxobutanoylamino) pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxobutanoylamino) pyrrolidine-2-carboxylate?
The IUPAC name of (4-oxobutanoylamino) pyrrolidine-2-carboxylate (CID 172627054) is (4-oxobutanoylamino) pyrrolidine-2-carboxylate.
What is the SMILES notation for (4-oxobutanoylamino) pyrrolidine-2-carboxylate?
The canonical SMILES for (4-oxobutanoylamino) pyrrolidine-2-carboxylate is O=CCCC(=O)NOC(=O)C1CCCN1.
What is the InChIKey of (4-oxobutanoylamino) pyrrolidine-2-carboxylate?
The InChIKey is TZTYYMSKFQCQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c12-6-2-4-8(13)11-15-9(14)7-3-1-5-10-7/h6-7,10H,1-5H2,(H,11,13).
What are the key properties of (4-oxobutanoylamino) pyrrolidine-2-carboxylate?
(4-oxobutanoylamino) pyrrolidine-2-carboxylate has a molecular weight of 214.22 g/mol, XLogP of -0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxobutanoylamino) pyrrolidine-2-carboxylate is sourced from PubChem (CID 172627054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).