About (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate
(2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate (PubChem CID 57173550) has the molecular formula C6H12N4O3
and a molecular weight of 188.19 g/mol. Its IUPAC name is (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 57173550 |
| Molecular Formula | C6H12N4O3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate |
| SMILES | NC(=O)NNOC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C6H12N4O3/c7-6(12)9-10-13-5(11)4-2-1-3-8-4/h4,8,10H,1-3H2,(H3,7,9,12)/t4-/m0/s1 |
| InChIKey | KNFZDGWXNRGMHZ-BYPYZUCNSA-N |
| XLogP | -1.63 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate (CID 57173550) is (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate is NC(=O)NNOC(=O)[C@@H]1CCCN1.
What is the InChIKey of (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate?
The InChIKey is KNFZDGWXNRGMHZ-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H12N4O3/c7-6(12)9-10-13-5(11)4-2-1-3-8-4/h4,8,10H,1-3H2,(H3,7,9,12)/t4-/m0/s1.
What are the key properties of (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate?
(2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate has a molecular weight of 188.19 g/mol, XLogP of -1.63, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylhydrazinyl) (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 57173550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).