C24H19N3O3S — CID 172627315
6-ethynyl-N-[5-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepin-2-yl]pyridine-3-carboxamide (PubChem CID 172627315) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is 6-ethynyl-N-[5-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepin-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-ethynyl-N-[5-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172627315 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 6-ethynyl-N-[5-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepin-2-yl]pyridine-3-carboxamide |
| SMILES | C#Cc1ccc(C(=O)Nc2ccc3c(c2)Sc2ccccc2C(=O)N3CCOC)cn1 |
| InChI | InChI=1S/C24H19N3O3S/c1-3-17-9-8-16(15-25-17)23(28)26-18-10-11-20-22(14-18)31-21-7-5-4-6-19(21)24(29)27(20)12-13-30-2/h1,4-11,14-15H,12-13H2,2H3,(H,26,28) |
| InChIKey | MGENQEKTXKQIRR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|