C25H27N3O3S — CID 172627314
1-cyclohexyl-3-[6-oxo-5-(2-prop-2-ynoxyethyl)benzo[b][1,4]benzothiazepin-2-yl]urea (PubChem CID 172627314) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-oxo-5-(2-prop-2-ynoxyethyl)benzo[b][1,4]benzothiazepin-2-yl]urea.
| Compound Name | 1-cyclohexyl-3-[6-oxo-5-(2-prop-2-ynoxyethyl)benzo[b][1,4]benzothiazepin-2-yl]urea |
|---|---|
| PubChem CID | 172627314 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-cyclohexyl-3-[6-oxo-5-(2-prop-2-ynoxyethyl)benzo[b][1,4]benzothiazepin-2-yl]urea |
| SMILES | C#CCOCCN1C(=O)c2ccccc2Sc2cc(NC(=O)NC3CCCCC3)ccc21 |
| InChI | InChI=1S/C25H27N3O3S/c1-2-15-31-16-14-28-21-13-12-19(27-25(30)26-18-8-4-3-5-9-18)17-23(21)32-22-11-7-6-10-20(22)24(28)29/h1,6-7,10-13,17-18H,3-5,8-9,14-16H2,(H2,26,27,30) |
| InChIKey | HCMISSCGXHVGAO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|