C22H25N3O3S — CID 172630319
1-[(1E,3Z)-1,4-diamino-4-(2-hydroxysulfanyloxyphenyl)buta-1,3-dien-2-yl]-4-phenylpiperidine-4-carbaldehyde (PubChem CID 172630319) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[(1E,3Z)-1,4-diamino-4-(2-hydroxysulfanyloxyphenyl)buta-1,3-dien-2-yl]-4-phenylpiperidine-4-carbaldehyde.
| Compound Name | 1-[(1E,3Z)-1,4-diamino-4-(2-hydroxysulfanyloxyphenyl)buta-1,3-dien-2-yl]-4-phenylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 172630319 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[(1E,3Z)-1,4-diamino-4-(2-hydroxysulfanyloxyphenyl)buta-1,3-dien-2-yl]-4-phenylpiperidine-4-carbaldehyde |
| SMILES | N/C=C(\C=C(/N)c1ccccc1OSO)N1CCC(C=O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N3O3S/c23-15-18(14-20(24)19-8-4-5-9-21(19)28-29-27)25-12-10-22(16-26,11-13-25)17-6-2-1-3-7-17/h1-9,14-16,27H,10-13,23-24H2/b18-15+,20-14- |
| InChIKey | NUUIYASUVYWNAW-IHRGLGMASA-N |
| XLogP | 3.52 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|