C19H20BrN7O2S — CID 172631214
6-bromo-3-[3,4-dimethoxy-5-[(1-methylpyrazol-4-yl)sulfanylamino]phenyl]-N-methylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 172631214) has the molecular formula C19H20BrN7O2S and a molecular weight of 490.39 g/mol. Its IUPAC name is 6-bromo-3-[3,4-dimethoxy-5-[(1-methylpyrazol-4-yl)sulfanylamino]phenyl]-N-methylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-bromo-3-[3,4-dimethoxy-5-[(1-methylpyrazol-4-yl)sulfanylamino]phenyl]-N-methylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 172631214 |
| Molecular Formula | C19H20BrN7O2S |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 6-bromo-3-[3,4-dimethoxy-5-[(1-methylpyrazol-4-yl)sulfanylamino]phenyl]-N-methylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CNc1nc(Br)cn2c(-c3cc(NSc4cnn(C)c4)c(OC)c(OC)c3)cnc12 |
| InChI | InChI=1S/C19H20BrN7O2S/c1-21-18-19-22-8-14(27(19)10-16(20)24-18)11-5-13(17(29-4)15(6-11)28-3)25-30-12-7-23-26(2)9-12/h5-10,25H,1-4H3,(H,21,24) |
| InChIKey | WOCOTCGSDPJKGK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|