C26H26N4O5 — CID 71448690
3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]-N,N-dimethylbenzamide (PubChem CID 71448690) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 71448690 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]-N,N-dimethylbenzamide |
| SMILES | COc1cc(-c2cnc3c(NC=O)cc(-c4cccc(C(=O)N(C)C)c4)cn23)cc(OC)c1OC |
| InChI | InChI=1S/C26H26N4O5/c1-29(2)26(32)17-8-6-7-16(9-17)19-10-20(28-15-31)25-27-13-21(30(25)14-19)18-11-22(33-3)24(35-5)23(12-18)34-4/h6-15H,1-5H3,(H,28,31) |
| InChIKey | GMNPZLZHSAAMCN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|