C27H25N3O5S — CID 135173774
3-[4-methoxy-3-[3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]anilino]sulfanylphenyl]-N,N-dimethylbenzamide (PubChem CID 135173774) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is 3-[4-methoxy-3-[3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]anilino]sulfanylphenyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[4-methoxy-3-[3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]anilino]sulfanylphenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 135173774 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 3-[4-methoxy-3-[3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]anilino]sulfanylphenyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1SNc1cccc(Nc2c(OC)c(=O)c2=O)c1 |
| InChI | InChI=1S/C27H25N3O5S/c1-30(2)27(33)18-8-5-7-16(13-18)17-11-12-21(34-3)22(14-17)36-29-20-10-6-9-19(15-20)28-23-24(31)25(32)26(23)35-4/h5-15,28-29H,1-4H3 |
| InChIKey | CSQZQQQEDUMQAA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|