C29H28N4O3S — CID 135173399
3-[4-methoxy-3-[3-(phenylcarbamoylamino)anilino]sulfanylphenyl]-N,N-dimethylbenzamide (PubChem CID 135173399) has the molecular formula C29H28N4O3S and a molecular weight of 512.64 g/mol. Its IUPAC name is 3-[4-methoxy-3-[3-(phenylcarbamoylamino)anilino]sulfanylphenyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[4-methoxy-3-[3-(phenylcarbamoylamino)anilino]sulfanylphenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 135173399 |
| Molecular Formula | C29H28N4O3S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-[4-methoxy-3-[3-(phenylcarbamoylamino)anilino]sulfanylphenyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1SNc1cccc(NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C29H28N4O3S/c1-33(2)28(34)22-10-7-9-20(17-22)21-15-16-26(36-3)27(18-21)37-32-25-14-8-13-24(19-25)31-29(35)30-23-11-5-4-6-12-23/h4-19,32H,1-3H3,(H2,30,31,35) |
| InChIKey | DLZZDJLULNNWCB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|