C18H20INO4S — CID 145204144
3-[3-[(1S)-1-iodoethyl]sulfonyl-4-methoxyphenyl]-N,N-dimethylbenzamide (PubChem CID 145204144) has the molecular formula C18H20INO4S and a molecular weight of 473.33 g/mol. Its IUPAC name is 3-[3-[(1S)-1-iodoethyl]sulfonyl-4-methoxyphenyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[3-[(1S)-1-iodoethyl]sulfonyl-4-methoxyphenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 145204144 |
| Molecular Formula | C18H20INO4S |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 3-[3-[(1S)-1-iodoethyl]sulfonyl-4-methoxyphenyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1S(=O)(=O)[C@H](C)I |
| InChI | InChI=1S/C18H20INO4S/c1-12(19)25(22,23)17-11-14(8-9-16(17)24-4)13-6-5-7-15(10-13)18(21)20(2)3/h5-12H,1-4H3/t12-/m1/s1 |
| InChIKey | OMBMGTAWVFUKJV-GFCCVEGCSA-N |
| XLogP | 3.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|