C32H31N5O5S — CID 122610596
3-cyano-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide (PubChem CID 122610596) has the molecular formula C32H31N5O5S and a molecular weight of 597.70 g/mol. Its IUPAC name is 3-cyano-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide.
| Compound Name | 3-cyano-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 122610596 |
| Molecular Formula | C32H31N5O5S |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 3-cyano-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1S(=O)(=O)Nc1cccc(NCCNC(=O)c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C32H31N5O5S/c1-37(2)32(39)26-10-5-8-23(18-26)24-13-14-29(42-3)30(19-24)43(40,41)36-28-12-6-11-27(20-28)34-15-16-35-31(38)25-9-4-7-22(17-25)21-33/h4-14,17-20,34,36H,15-16H2,1-3H3,(H,35,38) |
| InChIKey | XMJALKSPWRGSLT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|