C34H39N5O5S — CID 166635434
N-[2-[3-[[5-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide (PubChem CID 166635434) has the molecular formula C34H39N5O5S and a molecular weight of 629.78 g/mol. Its IUPAC name is N-[2-[3-[[5-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[3-[[5-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 166635434 |
| Molecular Formula | C34H39N5O5S |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | N-[2-[3-[[5-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)NCCN(C)C)c2)cc1S(=O)(=O)Nc1cccc(NCCNC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C34H39N5O5S/c1-24-8-5-10-27(20-24)33(40)36-17-16-35-29-12-7-13-30(23-29)38-45(42,43)32-22-26(14-15-31(32)44-4)25-9-6-11-28(21-25)34(41)37-18-19-39(2)3/h5-15,20-23,35,38H,16-19H2,1-4H3,(H,36,40)(H,37,41) |
| InChIKey | BZLLPQORIPMPMN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|