C38H39N5O5S — CID 166635987
N-[2-[3-[[2-methoxy-5-[3-[methyl(2-pyridin-4-ylethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide (PubChem CID 166635987) has the molecular formula C38H39N5O5S and a molecular weight of 677.83 g/mol. Its IUPAC name is N-[2-[3-[[2-methoxy-5-[3-[methyl(2-pyridin-4-ylethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[3-[[2-methoxy-5-[3-[methyl(2-pyridin-4-ylethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 166635987 |
| Molecular Formula | C38H39N5O5S |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | N-[2-[3-[[2-methoxy-5-[3-[methyl(2-pyridin-4-ylethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)CCc3ccncc3)c2)cc1S(=O)(=O)Nc1cccc(NCCNC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C38H39N5O5S/c1-27-7-4-9-31(23-27)37(44)41-21-20-40-33-11-6-12-34(26-33)42-49(46,47)36-25-30(13-14-35(36)48-3)29-8-5-10-32(24-29)38(45)43(2)22-17-28-15-18-39-19-16-28/h4-16,18-19,23-26,40,42H,17,20-22H2,1-3H3,(H,41,44) |
| InChIKey | NCGVSVVLKIHANQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|