C29H32N6O5S — CID 122610600
N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 122610600) has the molecular formula C29H32N6O5S and a molecular weight of 576.68 g/mol. Its IUPAC name is N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 122610600 |
| Molecular Formula | C29H32N6O5S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1S(=O)(=O)Nc1cccc(NCCNC(=O)c2ccnn2C)c1 |
| InChI | InChI=1S/C29H32N6O5S/c1-34(2)29(37)22-8-5-7-20(17-22)21-11-12-26(40-4)27(18-21)41(38,39)33-24-10-6-9-23(19-24)30-15-16-31-28(36)25-13-14-32-35(25)3/h5-14,17-19,30,33H,15-16H2,1-4H3,(H,31,36) |
| InChIKey | BGDWLPQIGPAALX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|