C29H29ClN4O5S2 — CID 122610613
5-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]thiophene-2-carboxamide (PubChem CID 122610613) has the molecular formula C29H29ClN4O5S2 and a molecular weight of 613.16 g/mol. Its IUPAC name is 5-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122610613 |
| Molecular Formula | C29H29ClN4O5S2 |
| Molecular Weight | 613.16 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 5-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1S(=O)(=O)Nc1cccc(NCCNC(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C29H29ClN4O5S2/c1-34(2)29(36)21-7-4-6-19(16-21)20-10-11-24(39-3)26(17-20)41(37,38)33-23-9-5-8-22(18-23)31-14-15-32-28(35)25-12-13-27(30)40-25/h4-13,16-18,31,33H,14-15H2,1-3H3,(H,32,35) |
| InChIKey | IHYOQURGXKAGMD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.16 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|