C35H39N3O4S — CID 163528634
3-[3-[[(7S,8S)-8-[benzyl(methyl)amino]-7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl]sulfamoyl]-4-methoxyphenyl]-N,N-dimethylbenzamide (PubChem CID 163528634) has the molecular formula C35H39N3O4S and a molecular weight of 597.78 g/mol. Its IUPAC name is 3-[3-[[(7S,8S)-8-[benzyl(methyl)amino]-7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl]sulfamoyl]-4-methoxyphenyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[3-[[(7S,8S)-8-[benzyl(methyl)amino]-7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl]sulfamoyl]-4-methoxyphenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 163528634 |
| Molecular Formula | C35H39N3O4S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 3-[3-[[(7S,8S)-8-[benzyl(methyl)amino]-7-methyl-5,6,7,8-tetrahydronaphthalen-2-yl]sulfamoyl]-4-methoxyphenyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1S(=O)(=O)Nc1ccc2c(c1)[C@@H](N(C)Cc1ccccc1)[C@@H](C)CC2 |
| InChI | InChI=1S/C35H39N3O4S/c1-24-14-15-26-16-18-30(22-31(26)34(24)38(4)23-25-10-7-6-8-11-25)36-43(40,41)33-21-28(17-19-32(33)42-5)27-12-9-13-29(20-27)35(39)37(2)3/h6-13,16-22,24,34,36H,14-15,23H2,1-5H3/t24-,34-/m0/s1 |
| InChIKey | DRAFTYXDHYILRC-WOPWWUTRSA-N |
| XLogP | 6.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |